C14H17FO — CID 105475976
[2-cyclobutyl-2-(4-fluorophenyl)cyclopropyl]methanol (PubChem CID 105475976) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is [2-cyclobutyl-2-(4-fluorophenyl)cyclopropyl]methanol.
| Compound Name | [2-cyclobutyl-2-(4-fluorophenyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 105475976 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [2-cyclobutyl-2-(4-fluorophenyl)cyclopropyl]methanol |
| SMILES | OCC1CC1(c1ccc(F)cc1)C1CCC1 |
| InChI | InChI=1S/C14H17FO/c15-13-6-4-11(5-7-13)14(8-12(14)9-16)10-2-1-3-10/h4-7,10,12,16H,1-3,8-9H2 |
| InChIKey | LBWOZAJWVPRDDU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |