C13H17FN2 — CID 105475990
[2-(4-fluorophenyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanamine (PubChem CID 105475990) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanamine.
| Compound Name | [2-(4-fluorophenyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanamine |
|---|---|
| PubChem CID | 105475990 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | [2-(4-fluorophenyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanamine |
| SMILES | NCC1C2CCC(C2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2/c14-10-2-5-11(6-3-10)16-12-4-1-9(7-12)13(16)8-15/h2-3,5-6,9,12-13H,1,4,7-8,15H2 |
| InChIKey | WWGXAYMUWAYBCO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |