C13H17FN2 — CID 105476077
N-cyclobutyl-6-fluoro-1,2,3,4-tetrahydroquinolin-3-amine (PubChem CID 105476077) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is N-cyclobutyl-6-fluoro-1,2,3,4-tetrahydroquinolin-3-amine.
| Compound Name | N-cyclobutyl-6-fluoro-1,2,3,4-tetrahydroquinolin-3-amine |
|---|---|
| PubChem CID | 105476077 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N-cyclobutyl-6-fluoro-1,2,3,4-tetrahydroquinolin-3-amine |
| SMILES | Fc1ccc2c(c1)CC(NC1CCC1)CN2 |
| InChI | InChI=1S/C13H17FN2/c14-10-4-5-13-9(6-10)7-12(8-15-13)16-11-2-1-3-11/h4-6,11-12,15-16H,1-3,7-8H2 |
| InChIKey | ODYNMQUGQKGAQX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |