C9H16O4S — CID 105476097
2-(4-methoxy-1,1-dioxothiepan-4-yl)acetaldehyde (PubChem CID 105476097) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(4-methoxy-1,1-dioxothiepan-4-yl)acetaldehyde.
| Compound Name | 2-(4-methoxy-1,1-dioxothiepan-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 105476097 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(4-methoxy-1,1-dioxothiepan-4-yl)acetaldehyde |
| SMILES | COC1(CC=O)CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H16O4S/c1-13-9(4-6-10)3-2-7-14(11,12)8-5-9/h6H,2-5,7-8H2,1H3 |
| InChIKey | YDHQCYSLTJULGG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|