About (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine
(8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine (PubChem CID 105476911) has the molecular formula C12H13ClN2
and a molecular weight of 220.70 g/mol. Its IUPAC name is (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine.
Molecular Properties
| Compound Name | (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine |
| PubChem CID | 105476911 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine |
| SMILES | NCC1CCc2cc3cccc(Cl)c3n21 |
| InChI | InChI=1S/C12H13ClN2/c13-11-3-1-2-8-6-9-4-5-10(7-14)15(9)12(8)11/h1-3,6,10H,4-5,7,14H2 |
| InChIKey | YPTQHHRETXJONU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine?
The IUPAC name of (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine (CID 105476911) is (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine.
What is the SMILES notation for (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine?
The canonical SMILES for (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine is NCC1CCc2cc3cccc(Cl)c3n21.
What is the InChIKey of (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine?
The InChIKey is YPTQHHRETXJONU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2/c13-11-3-1-2-8-6-9-4-5-10(7-14)15(9)12(8)11/h1-3,6,10H,4-5,7,14H2.
What are the key properties of (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine?
(8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine has a molecular weight of 220.70 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl)methanamine is sourced from PubChem (CID 105476911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).