C20H17FN4OS — CID 10547809
(4-fluorophenyl)-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]methanone (PubChem CID 10547809) has the molecular formula C20H17FN4OS and a molecular weight of 380.45 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 10547809 |
| Molecular Formula | C20H17FN4OS |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (4-fluorophenyl)-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(c2nc3ccsc3n3cccc23)CC1 |
| InChI | InChI=1S/C20H17FN4OS/c21-15-5-3-14(4-6-15)19(26)24-11-9-23(10-12-24)18-17-2-1-8-25(17)20-16(22-18)7-13-27-20/h1-8,13H,9-12H2 |
| InChIKey | UJBVSJAOMNPPER-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |