About 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine
3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine (PubChem CID 105478788) has the molecular formula C8H9F3N2O2
and a molecular weight of 222.17 g/mol. Its IUPAC name is 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine.
Molecular Properties
| Compound Name | 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine |
| PubChem CID | 105478788 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine |
| SMILES | FC(F)(F)c1cnc(C2COCCN2)o1 |
| InChI | InChI=1S/C8H9F3N2O2/c9-8(10,11)6-3-13-7(15-6)5-4-14-2-1-12-5/h3,5,12H,1-2,4H2 |
| InChIKey | GTNNOUJNDODQCO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine?
The IUPAC name of 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine (CID 105478788) is 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine.
What is the SMILES notation for 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine?
The canonical SMILES for 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine is FC(F)(F)c1cnc(C2COCCN2)o1.
What is the InChIKey of 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine?
The InChIKey is GTNNOUJNDODQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2/c9-8(10,11)6-3-13-7(15-6)5-4-14-2-1-12-5/h3,5,12H,1-2,4H2.
What are the key properties of 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine?
3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine has a molecular weight of 222.17 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(trifluoromethyl)-1,3-oxazol-2-yl]morpholine is sourced from PubChem (CID 105478788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).