C13H22N2O — CID 105479644
3-amino-1,6-bis(2-methylpropyl)pyridin-2-one (PubChem CID 105479644) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-amino-1,6-bis(2-methylpropyl)pyridin-2-one.
| Compound Name | 3-amino-1,6-bis(2-methylpropyl)pyridin-2-one |
|---|---|
| PubChem CID | 105479644 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3-amino-1,6-bis(2-methylpropyl)pyridin-2-one |
| SMILES | CC(C)Cc1ccc(N)c(=O)n1CC(C)C |
| InChI | InChI=1S/C13H22N2O/c1-9(2)7-11-5-6-12(14)13(16)15(11)8-10(3)4/h5-6,9-10H,7-8,14H2,1-4H3 |
| InChIKey | AXSVWRVNSWPRCY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |