About ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate
ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate (PubChem CID 10547974) has the molecular formula C16H16Cl2N4O3
and a molecular weight of 383.24 g/mol. Its IUPAC name is ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate.
Molecular Properties
| Compound Name | ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate |
| PubChem CID | 10547974 |
| Molecular Formula | C16H16Cl2N4O3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)C/C(Cn1ncc(Cl)c(Cl)c1=O)=N\Nc1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N4O3/c1-2-25-14(23)8-12(21-20-11-6-4-3-5-7-11)10-22-16(24)15(18)13(17)9-19-22/h3-7,9,20H,2,8,10H2,1H3/b21-12+ |
| InChIKey | YQKPDVGUFTYLFW-CIAFOILYSA-N |
| XLogP | 2.97 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate?
The IUPAC name of ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate (CID 10547974) is ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate.
What is the SMILES notation for ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate?
The canonical SMILES for ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate is CCOC(=O)C/C(Cn1ncc(Cl)c(Cl)c1=O)=N\Nc1ccccc1.
What is the InChIKey of ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate?
The InChIKey is YQKPDVGUFTYLFW-CIAFOILYSA-N. The full InChI is InChI=1S/C16H16Cl2N4O3/c1-2-25-14(23)8-12(21-20-11-6-4-3-5-7-11)10-22-16(24)15(18)13(17)9-19-22/h3-7,9,20H,2,8,10H2,1H3/b21-12+.
What are the key properties of ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate?
ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate has a molecular weight of 383.24 g/mol, XLogP of 2.97, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3E)-4-(4,5-dichloro-6-oxopyridazin-1-yl)-3-(phenylhydrazinylidene)butanoate is sourced from PubChem (CID 10547974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).