C11H17N3O2 — CID 105480566
(4-cyclobutyl-2,6-dimethoxypyrimidin-5-yl)methanamine (PubChem CID 105480566) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is (4-cyclobutyl-2,6-dimethoxypyrimidin-5-yl)methanamine.
| Compound Name | (4-cyclobutyl-2,6-dimethoxypyrimidin-5-yl)methanamine |
|---|---|
| PubChem CID | 105480566 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | (4-cyclobutyl-2,6-dimethoxypyrimidin-5-yl)methanamine |
| SMILES | COc1nc(OC)c(CN)c(C2CCC2)n1 |
| InChI | InChI=1S/C11H17N3O2/c1-15-10-8(6-12)9(7-4-3-5-7)13-11(14-10)16-2/h7H,3-6,12H2,1-2H3 |
| InChIKey | YTMYVVJNLYUKDG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |