C9H18FNO2S — CID 105480916
3-(1,1-dioxothian-4-yl)-3-fluorobutan-1-amine (PubChem CID 105480916) has the molecular formula C9H18FNO2S and a molecular weight of 223.31 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-3-fluorobutan-1-amine.
| Compound Name | 3-(1,1-dioxothian-4-yl)-3-fluorobutan-1-amine |
|---|---|
| PubChem CID | 105480916 |
| Molecular Formula | C9H18FNO2S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-3-fluorobutan-1-amine |
| SMILES | CC(F)(CCN)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H18FNO2S/c1-9(10,4-5-11)8-2-6-14(12,13)7-3-8/h8H,2-7,11H2,1H3 |
| InChIKey | FVYQPYGKHLJNRI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |