About 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine
3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine (PubChem CID 105480918) has the molecular formula C9H18FNO2S
and a molecular weight of 223.31 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine |
| PubChem CID | 105480918 |
| Molecular Formula | C9H18FNO2S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine |
| SMILES | CNCCC(C)(F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18FNO2S/c1-9(10,4-5-11-2)8-3-6-14(12,13)7-8/h8,11H,3-7H2,1-2H3 |
| InChIKey | SCLJSRLKDSMBJD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine (CID 105480918) is 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine is CNCCC(C)(F)C1CCS(=O)(=O)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine?
The InChIKey is SCLJSRLKDSMBJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FNO2S/c1-9(10,4-5-11-2)8-3-6-14(12,13)7-8/h8,11H,3-7H2,1-2H3.
What are the key properties of 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine?
3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine has a molecular weight of 223.31 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)-3-fluoro-N-methylbutan-1-amine is sourced from PubChem (CID 105480918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).