C9H18F2N2O2 — CID 105481710
tert-butyl N-(4-amino-1,1-difluorobutan-2-yl)carbamate (PubChem CID 105481710) has the molecular formula C9H18F2N2O2 and a molecular weight of 224.25 g/mol. Its IUPAC name is tert-butyl N-(4-amino-1,1-difluorobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-amino-1,1-difluorobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 105481710 |
| Molecular Formula | C9H18F2N2O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | tert-butyl N-(4-amino-1,1-difluorobutan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCN)C(F)F |
| InChI | InChI=1S/C9H18F2N2O2/c1-9(2,3)15-8(14)13-6(4-5-12)7(10)11/h6-7H,4-5,12H2,1-3H3,(H,13,14) |
| InChIKey | UUYRNVXZKYRAKC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |