C8H13FO4S — CID 105481724
methyl 3-(1,1-dioxothiolan-3-yl)-2-fluoropropanoate (PubChem CID 105481724) has the molecular formula C8H13FO4S and a molecular weight of 224.25 g/mol. Its IUPAC name is methyl 3-(1,1-dioxothiolan-3-yl)-2-fluoropropanoate.
| Compound Name | methyl 3-(1,1-dioxothiolan-3-yl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 105481724 |
| Molecular Formula | C8H13FO4S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | methyl 3-(1,1-dioxothiolan-3-yl)-2-fluoropropanoate |
| SMILES | COC(=O)C(F)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13FO4S/c1-13-8(10)7(9)4-6-2-3-14(11,12)5-6/h6-7H,2-5H2,1H3 |
| InChIKey | BNXMLNHFJBCTJB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |