About 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid
2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid (PubChem CID 105481851) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid |
| PubChem CID | 105481851 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid |
| SMILES | CC(C)(C)n1nc2c(c1C(=O)O)COCC2 |
| InChI | InChI=1S/C11H16N2O3/c1-11(2,3)13-9(10(14)15)7-6-16-5-4-8(7)12-13/h4-6H2,1-3H3,(H,14,15) |
| InChIKey | DVTSAOIDLIIXNY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
The IUPAC name of 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid (CID 105481851) is 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
The canonical SMILES for 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid is CC(C)(C)n1nc2c(c1C(=O)O)COCC2.
What is the InChIKey of 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
The InChIKey is DVTSAOIDLIIXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-11(2,3)13-9(10(14)15)7-6-16-5-4-8(7)12-13/h4-6H2,1-3H3,(H,14,15).
What are the key properties of 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid has a molecular weight of 224.26 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid is sourced from PubChem (CID 105481851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).