C20H25F3O4 — CID 10548190
[(2R,3R)-3-(cyclohexylmethyl)oxiran-2-yl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10548190) has the molecular formula C20H25F3O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is [(2R,3R)-3-(cyclohexylmethyl)oxiran-2-yl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R,3R)-3-(cyclohexylmethyl)oxiran-2-yl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10548190 |
| Molecular Formula | C20H25F3O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(2R,3R)-3-(cyclohexylmethyl)oxiran-2-yl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)OC[C@H]1O[C@@H]1CC1CCCCC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H25F3O4/c1-25-19(20(21,22)23,15-10-6-3-7-11-15)18(24)26-13-17-16(27-17)12-14-8-4-2-5-9-14/h3,6-7,10-11,14,16-17H,2,4-5,8-9,12-13H2,1H3/t16-,17-,19?/m1/s1 |
| InChIKey | GXKDAKMOXCKRGX-QNZPCDNOSA-N |
| XLogP | 4.37 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|