About 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile
5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile (PubChem CID 105481958) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile |
| PubChem CID | 105481958 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile |
| SMILES | CN1Cc2c(C#N)nn(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C13H12N4/c1-16-8-11-12(7-14)15-17(13(11)9-16)10-5-3-2-4-6-10/h2-6H,8-9H2,1H3 |
| InChIKey | QGWDIECCOGBHCQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile?
The IUPAC name of 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile (CID 105481958) is 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile.
What is the SMILES notation for 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile?
The canonical SMILES for 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile is CN1Cc2c(C#N)nn(-c3ccccc3)c2C1.
What is the InChIKey of 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile?
The InChIKey is QGWDIECCOGBHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c1-16-8-11-12(7-14)15-17(13(11)9-16)10-5-3-2-4-6-10/h2-6H,8-9H2,1H3.
What are the key properties of 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile?
5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile has a molecular weight of 224.27 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-phenyl-4,6-dihydropyrrolo[3,4-d]pyrazole-3-carbonitrile is sourced from PubChem (CID 105481958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).