C22H26O6 — CID 10548197
(2R,3S,4R,6R)-6-(1-hydroxy-9,10-dimethoxy-9,10-dihydroanthracen-2-yl)-2-methyloxane-3,4-diol (PubChem CID 10548197) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-(1-hydroxy-9,10-dimethoxy-9,10-dihydroanthracen-2-yl)-2-methyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-6-(1-hydroxy-9,10-dimethoxy-9,10-dihydroanthracen-2-yl)-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 10548197 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2R,3S,4R,6R)-6-(1-hydroxy-9,10-dimethoxy-9,10-dihydroanthracen-2-yl)-2-methyloxane-3,4-diol |
| SMILES | COC1c2ccccc2C(OC)c2c1ccc([C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1)c2O |
| InChI | InChI=1S/C22H26O6/c1-11-19(24)16(23)10-17(28-11)14-8-9-15-18(20(14)25)22(27-3)13-7-5-4-6-12(13)21(15)26-2/h4-9,11,16-17,19,21-25H,10H2,1-3H3/t11-,16-,17-,19-,21?,22?/m1/s1 |
| InChIKey | GFFKSIFIZCTWCL-VCKJDJGVSA-N |
| XLogP | 2.75 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |