C20H16Cl2N2O2 — CID 10548245
6,10-dichloro-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaene-14,16-dione (PubChem CID 10548245) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 6,10-dichloro-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaene-14,16-dione.
| Compound Name | 6,10-dichloro-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaene-14,16-dione |
|---|---|
| PubChem CID | 10548245 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 6,10-dichloro-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaene-14,16-dione |
| SMILES | CN(C)CCN1C(=O)c2ccc(Cl)c3cc4c(Cl)cccc4c(c23)C1=O |
| InChI | InChI=1S/C20H16Cl2N2O2/c1-23(2)8-9-24-19(25)12-6-7-16(22)14-10-13-11(4-3-5-15(13)21)18(17(12)14)20(24)26/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | YQGABQDOEFQYKK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|