C13H17F2N — CID 105483026
1-[2-[5-(difluoromethyl)-2-methylphenyl]ethyl]cyclopropan-1-amine (PubChem CID 105483026) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is 1-[2-[5-(difluoromethyl)-2-methylphenyl]ethyl]cyclopropan-1-amine.
| Compound Name | 1-[2-[5-(difluoromethyl)-2-methylphenyl]ethyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 105483026 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-[2-[5-(difluoromethyl)-2-methylphenyl]ethyl]cyclopropan-1-amine |
| SMILES | Cc1ccc(C(F)F)cc1CCC1(N)CC1 |
| InChI | InChI=1S/C13H17F2N/c1-9-2-3-11(12(14)15)8-10(9)4-5-13(16)6-7-13/h2-3,8,12H,4-7,16H2,1H3 |
| InChIKey | BPTOWDLBWGVEQQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |