C10H11ClN2O2 — CID 105484171
6-(4-chlorophenyl)-4-methyl-1,3,4-oxadiazinan-2-one (PubChem CID 105484171) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-methyl-1,3,4-oxadiazinan-2-one.
| Compound Name | 6-(4-chlorophenyl)-4-methyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 105484171 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 6-(4-chlorophenyl)-4-methyl-1,3,4-oxadiazinan-2-one |
| SMILES | CN1CC(c2ccc(Cl)cc2)OC(=O)N1 |
| InChI | InChI=1S/C10H11ClN2O2/c1-13-6-9(15-10(14)12-13)7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3,(H,12,14) |
| InChIKey | IVKOXROQIVAICU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |