About 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide
3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide (PubChem CID 10548464) has the molecular formula C23H19ClN2O2
and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide |
| PubChem CID | 10548464 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCc3ccccc32)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19ClN2O2/c24-19-8-3-6-18(15-19)22(27)25-20-12-10-17(11-13-20)23(28)26-14-4-7-16-5-1-2-9-21(16)26/h1-3,5-6,8-13,15H,4,7,14H2,(H,25,27) |
| InChIKey | DTCHNWYQYUTVHL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide?
The IUPAC name of 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide (CID 10548464) is 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide.
What is the SMILES notation for 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide?
The canonical SMILES for 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide is O=C(Nc1ccc(C(=O)N2CCCc3ccccc32)cc1)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide?
The InChIKey is DTCHNWYQYUTVHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClN2O2/c24-19-8-3-6-18(15-19)22(27)25-20-12-10-17(11-13-20)23(28)26-14-4-7-16-5-1-2-9-21(16)26/h1-3,5-6,8-13,15H,4,7,14H2,(H,25,27).
What are the key properties of 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide?
3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide has a molecular weight of 390.87 g/mol, XLogP of 5.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide is sourced from PubChem (CID 10548464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).