C13H14N2O2 — CID 105487728
4-[2-[1-(aminomethyl)cyclopropyl]-1,3-oxazol-4-yl]phenol (PubChem CID 105487728) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-[2-[1-(aminomethyl)cyclopropyl]-1,3-oxazol-4-yl]phenol.
| Compound Name | 4-[2-[1-(aminomethyl)cyclopropyl]-1,3-oxazol-4-yl]phenol |
|---|---|
| PubChem CID | 105487728 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-[2-[1-(aminomethyl)cyclopropyl]-1,3-oxazol-4-yl]phenol |
| SMILES | NCC1(c2nc(-c3ccc(O)cc3)co2)CC1 |
| InChI | InChI=1S/C13H14N2O2/c14-8-13(5-6-13)12-15-11(7-17-12)9-1-3-10(16)4-2-9/h1-4,7,16H,5-6,8,14H2 |
| InChIKey | QQZMYKBIQOJZFC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |