C21H19NO5S — CID 10548829
5-[[4-(2,3,6,7-tetrahydrocyclobuta[g][1,4]benzodioxin-6-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10548829) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 5-[[4-(2,3,6,7-tetrahydrocyclobuta[g][1,4]benzodioxin-6-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(2,3,6,7-tetrahydrocyclobuta[g][1,4]benzodioxin-6-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10548829 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-[[4-(2,3,6,7-tetrahydrocyclobuta[g][1,4]benzodioxin-6-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCC3Cc4cc5c(cc43)OCCO5)cc2)S1 |
| InChI | InChI=1S/C21H19NO5S/c23-20-19(28-21(24)22-20)7-12-1-3-15(4-2-12)27-11-14-8-13-9-17-18(10-16(13)14)26-6-5-25-17/h1-4,9-10,14,19H,5-8,11H2,(H,22,23,24) |
| InChIKey | GEZLVTILZJEKGC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|