C13H16N2O2 — CID 105490927
3-(4-hydroxyphenyl)-1,3-diazaspiro[4.4]nonan-2-one (PubChem CID 105490927) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1,3-diazaspiro[4.4]nonan-2-one.
| Compound Name | 3-(4-hydroxyphenyl)-1,3-diazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 105490927 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1,3-diazaspiro[4.4]nonan-2-one |
| SMILES | O=C1NC2(CCCC2)CN1c1ccc(O)cc1 |
| InChI | InChI=1S/C13H16N2O2/c16-11-5-3-10(4-6-11)15-9-13(14-12(15)17)7-1-2-8-13/h3-6,16H,1-2,7-9H2,(H,14,17) |
| InChIKey | JBTOMTNIHKMILP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |