About 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde
2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde (PubChem CID 105491752) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
| PubChem CID | 105491752 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde |
| SMILES | O=Cc1c2c(nn1C1CCCCC1)CCCC2 |
| InChI | InChI=1S/C14H20N2O/c17-10-14-12-8-4-5-9-13(12)15-16(14)11-6-2-1-3-7-11/h10-11H,1-9H2 |
| InChIKey | XQJPGVSLSNXCAC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde?
The IUPAC name of 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde (CID 105491752) is 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde.
What is the SMILES notation for 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde?
The canonical SMILES for 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde is O=Cc1c2c(nn1C1CCCCC1)CCCC2.
What is the InChIKey of 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde?
The InChIKey is XQJPGVSLSNXCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c17-10-14-12-8-4-5-9-13(12)15-16(14)11-6-2-1-3-7-11/h10-11H,1-9H2.
What are the key properties of 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde?
2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde has a molecular weight of 232.33 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4,5,6,7-tetrahydroindazole-3-carbaldehyde is sourced from PubChem (CID 105491752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).