About (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine
(6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine (PubChem CID 105492123) has the molecular formula C10H14Cl2N2
and a molecular weight of 233.14 g/mol. Its IUPAC name is (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine.
Molecular Properties
| Compound Name | (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine |
| PubChem CID | 105492123 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine |
| SMILES | CC(C)(C)c1nc(Cl)c(CN)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-10(2,3)8-7(11)4-6(5-13)9(12)14-8/h4H,5,13H2,1-3H3 |
| InChIKey | NJZQFRRTICTUBP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine?
The IUPAC name of (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine (CID 105492123) is (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine.
What is the SMILES notation for (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine?
The canonical SMILES for (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine is CC(C)(C)c1nc(Cl)c(CN)cc1Cl.
What is the InChIKey of (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine?
The InChIKey is NJZQFRRTICTUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N2/c1-10(2,3)8-7(11)4-6(5-13)9(12)14-8/h4H,5,13H2,1-3H3.
What are the key properties of (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine?
(6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine has a molecular weight of 233.14 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-tert-butyl-2,5-dichloro-3-pyridinyl)methanamine is sourced from PubChem (CID 105492123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).