C10H14F3N3 — CID 105492302
4-[[2-(trifluoromethyl)-1H-imidazol-5-yl]methyl]piperidine (PubChem CID 105492302) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 4-[[2-(trifluoromethyl)-1H-imidazol-5-yl]methyl]piperidine.
| Compound Name | 4-[[2-(trifluoromethyl)-1H-imidazol-5-yl]methyl]piperidine |
|---|---|
| PubChem CID | 105492302 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-[[2-(trifluoromethyl)-1H-imidazol-5-yl]methyl]piperidine |
| SMILES | FC(F)(F)c1ncc(CC2CCNCC2)[nH]1 |
| InChI | InChI=1S/C10H14F3N3/c11-10(12,13)9-15-6-8(16-9)5-7-1-3-14-4-2-7/h6-7,14H,1-5H2,(H,15,16) |
| InChIKey | NDXDMKKBLZEJOX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |