About 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine
3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine (PubChem CID 105493450) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine.
Molecular Properties
| Compound Name | 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine |
| PubChem CID | 105493450 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine |
| SMILES | Cc1ccn2c(C3CSCCN3)ncc2c1 |
| InChI | InChI=1S/C12H15N3S/c1-9-2-4-15-10(6-9)7-14-12(15)11-8-16-5-3-13-11/h2,4,6-7,11,13H,3,5,8H2,1H3 |
| InChIKey | NFIUSASOUWKJBL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine?
The IUPAC name of 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine (CID 105493450) is 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine.
What is the SMILES notation for 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine?
The canonical SMILES for 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine is Cc1ccn2c(C3CSCCN3)ncc2c1.
What is the InChIKey of 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine?
The InChIKey is NFIUSASOUWKJBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c1-9-2-4-15-10(6-9)7-14-12(15)11-8-16-5-3-13-11/h2,4,6-7,11,13H,3,5,8H2,1H3.
What are the key properties of 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine?
3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine has a molecular weight of 233.34 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methylimidazo[1,5-a]pyridin-3-yl)thiomorpholine is sourced from PubChem (CID 105493450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).