C14H23N3 — CID 105493650
2-[(4-cyclobutyl-5-methyl-1H-imidazol-2-yl)methyl]piperidine (PubChem CID 105493650) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-[(4-cyclobutyl-5-methyl-1H-imidazol-2-yl)methyl]piperidine.
| Compound Name | 2-[(4-cyclobutyl-5-methyl-1H-imidazol-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 105493650 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-[(4-cyclobutyl-5-methyl-1H-imidazol-2-yl)methyl]piperidine |
| SMILES | Cc1[nH]c(CC2CCCCN2)nc1C1CCC1 |
| InChI | InChI=1S/C14H23N3/c1-10-14(11-5-4-6-11)17-13(16-10)9-12-7-2-3-8-15-12/h11-12,15H,2-9H2,1H3,(H,16,17) |
| InChIKey | WNLFXGXZQIWBHE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |