C12H14N2O3 — CID 105494131
2-(4-methyl-2-oxo-1,3-diazinan-4-yl)benzoic acid (PubChem CID 105494131) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-diazinan-4-yl)benzoic acid.
| Compound Name | 2-(4-methyl-2-oxo-1,3-diazinan-4-yl)benzoic acid |
|---|---|
| PubChem CID | 105494131 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-diazinan-4-yl)benzoic acid |
| SMILES | CC1(c2ccccc2C(=O)O)CCNC(=O)N1 |
| InChI | InChI=1S/C12H14N2O3/c1-12(6-7-13-11(17)14-12)9-5-3-2-4-8(9)10(15)16/h2-5H,6-7H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | GZCDFQKRTYYZPL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |