About 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide
4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 10549466) has the molecular formula C18H14F3N3O3S
and a molecular weight of 409.39 g/mol. Its IUPAC name is 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| PubChem CID | 10549466 |
| Molecular Formula | C18H14F3N3O3S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C18H14F3N3O3S/c19-18(20,21)17-10-15(11-1-6-16-12(9-11)7-8-27-16)24(23-17)13-2-4-14(5-3-13)28(22,25)26/h1-6,9-10H,7-8H2,(H2,22,25,26) |
| InChIKey | SWLWPNCYNMXQOD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CID 10549466) is 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc3c(c2)CCO3)cc1.
What is the InChIKey of 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The InChIKey is SWLWPNCYNMXQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N3O3S/c19-18(20,21)17-10-15(11-1-6-16-12(9-11)7-8-27-16)24(23-17)13-2-4-14(5-3-13)28(22,25)26/h1-6,9-10H,7-8H2,(H2,22,25,26).
What are the key properties of 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide has a molecular weight of 409.39 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,3-dihydro-1-benzofuran-5-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 10549466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).