About 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol
6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol (PubChem CID 105494684) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol.
Molecular Properties
| Compound Name | 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol |
| PubChem CID | 105494684 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol |
| SMILES | COc1ccc2c(c1)NC1(CCNCC1)C2O |
| InChI | InChI=1S/C13H18N2O2/c1-17-9-2-3-10-11(8-9)15-13(12(10)16)4-6-14-7-5-13/h2-3,8,12,14-16H,4-7H2,1H3 |
| InChIKey | RHQAATSTOHWSOQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol?
The IUPAC name of 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol (CID 105494684) is 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol.
What is the SMILES notation for 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol?
The canonical SMILES for 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol is COc1ccc2c(c1)NC1(CCNCC1)C2O.
What is the InChIKey of 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol?
The InChIKey is RHQAATSTOHWSOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-17-9-2-3-10-11(8-9)15-13(12(10)16)4-6-14-7-5-13/h2-3,8,12,14-16H,4-7H2,1H3.
What are the key properties of 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol?
6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol has a molecular weight of 234.30 g/mol, XLogP of 1.28, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol is sourced from PubChem (CID 105494684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).