C13H18N2O2 — CID 105494684
6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol (PubChem CID 105494684) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol.
| Compound Name | 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol |
|---|---|
| PubChem CID | 105494684 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 6-methoxyspiro[1,3-dihydroindole-2,4'-piperidine]-3-ol |
| SMILES | COc1ccc2c(c1)NC1(CCNCC1)C2O |
| InChI | InChI=1S/C13H18N2O2/c1-17-9-2-3-10-11(8-9)15-13(12(10)16)4-6-14-7-5-13/h2-3,8,12,14-16H,4-7H2,1H3 |
| InChIKey | RHQAATSTOHWSOQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |