About 3-(1,1-dioxothian-3-yl)-3-methoxybutanal
3-(1,1-dioxothian-3-yl)-3-methoxybutanal (PubChem CID 105494896) has the molecular formula C10H18O4S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-3-methoxybutanal.
Molecular Properties
| Compound Name | 3-(1,1-dioxothian-3-yl)-3-methoxybutanal |
| PubChem CID | 105494896 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-3-methoxybutanal |
| SMILES | COC(C)(CC=O)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18O4S/c1-10(14-2,5-6-11)9-4-3-7-15(12,13)8-9/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | QVVIKUYEKPHOBF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dioxothian-3-yl)-3-methoxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothian-3-yl)-3-methoxybutanal?
The IUPAC name of 3-(1,1-dioxothian-3-yl)-3-methoxybutanal (CID 105494896) is 3-(1,1-dioxothian-3-yl)-3-methoxybutanal.
What is the SMILES notation for 3-(1,1-dioxothian-3-yl)-3-methoxybutanal?
The canonical SMILES for 3-(1,1-dioxothian-3-yl)-3-methoxybutanal is COC(C)(CC=O)C1CCCS(=O)(=O)C1.
What is the InChIKey of 3-(1,1-dioxothian-3-yl)-3-methoxybutanal?
The InChIKey is QVVIKUYEKPHOBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4S/c1-10(14-2,5-6-11)9-4-3-7-15(12,13)8-9/h6,9H,3-5,7-8H2,1-2H3.
What are the key properties of 3-(1,1-dioxothian-3-yl)-3-methoxybutanal?
3-(1,1-dioxothian-3-yl)-3-methoxybutanal has a molecular weight of 234.32 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothian-3-yl)-3-methoxybutanal is sourced from PubChem (CID 105494896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).