C23H42O4Si — CID 10549531
methyl 7-[(1R,2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]heptanoate (PubChem CID 10549531) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10549531 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]heptanoate |
| SMILES | C=CCC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H42O4Si/c1-8-9-14-19-18(15-12-10-11-13-16-22(25)26-5)20(24)17-21(19)27-28(6,7)23(2,3)4/h8,18-19,21H,1,9-17H2,2-7H3/t18-,19-,21-/m1/s1 |
| InChIKey | BKDMGXVHSKNANH-SFHLNBCPSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|