C22H42O3Si2 — CID 10549535
(1R,4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 10549535) has the molecular formula C22H42O3Si2 and a molecular weight of 410.75 g/mol. Its IUPAC name is (1R,4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (1R,4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 10549535 |
| Molecular Formula | C22H42O3Si2 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (1R,4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | C[C@H]1C(=O)C=C2[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O3Si2/c1-15-16-12-13-19(24-26(8,9)21(2,3)4)20(17(16)14-18(15)23)25-27(10,11)22(5,6)7/h14-16,19-20H,12-13H2,1-11H3/t15-,16+,19+,20+/m1/s1 |
| InChIKey | AGDYYXFSEFXADO-LPWQTFTOSA-N |
| XLogP | 6.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|