C21H29N7O2 — CID 10549573
1,3,7-trimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purine-2,6-dione (PubChem CID 10549573) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purine-2,6-dione |
|---|---|
| PubChem CID | 10549573 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1,3,7-trimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCCN3CCN(c4ccccc4)CC3)n2C)n(C)c1=O |
| InChI | InChI=1S/C21H29N7O2/c1-24-17-18(25(2)21(30)26(3)19(17)29)23-20(24)22-10-7-11-27-12-14-28(15-13-27)16-8-5-4-6-9-16/h4-6,8-9H,7,10-15H2,1-3H3,(H,22,23) |
| InChIKey | QUXSGHITMJNDAB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|