About 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one
2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one (PubChem CID 105496154) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one |
| PubChem CID | 105496154 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one |
| SMILES | CC(C)C1(C)CC(=O)N(c2cccc(O)c2)O1 |
| InChI | InChI=1S/C13H17NO3/c1-9(2)13(3)8-12(16)14(17-13)10-5-4-6-11(15)7-10/h4-7,9,15H,8H2,1-3H3 |
| InChIKey | XACLRMJMAOHHTO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one?
The IUPAC name of 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one (CID 105496154) is 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one.
What is the SMILES notation for 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one?
The canonical SMILES for 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one is CC(C)C1(C)CC(=O)N(c2cccc(O)c2)O1.
What is the InChIKey of 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one?
The InChIKey is XACLRMJMAOHHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-9(2)13(3)8-12(16)14(17-13)10-5-4-6-11(15)7-10/h4-7,9,15H,8H2,1-3H3.
What are the key properties of 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one?
2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one has a molecular weight of 235.28 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxyphenyl)-5-methyl-5-propan-2-yl-1,2-oxazolidin-3-one is sourced from PubChem (CID 105496154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).