C21H19NO6S — CID 10549665
2-methylsulfonylethyl (1R,9S,12Z,16R,18S)-16-hydroxy-16-methyl-17-oxa-8-azatetracyclo[7.7.2.01,18.02,7]octadeca-2,4,6,12-tetraen-10,14-diyne-8-carboxylate (PubChem CID 10549665) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-methylsulfonylethyl (1R,9S,12Z,16R,18S)-16-hydroxy-16-methyl-17-oxa-8-azatetracyclo[7.7.2.01,18.02,7]octadeca-2,4,6,12-tetraen-10,14-diyne-8-carboxylate.
| Compound Name | 2-methylsulfonylethyl (1R,9S,12Z,16R,18S)-16-hydroxy-16-methyl-17-oxa-8-azatetracyclo[7.7.2.01,18.02,7]octadeca-2,4,6,12-tetraen-10,14-diyne-8-carboxylate |
|---|---|
| PubChem CID | 10549665 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-methylsulfonylethyl (1R,9S,12Z,16R,18S)-16-hydroxy-16-methyl-17-oxa-8-azatetracyclo[7.7.2.01,18.02,7]octadeca-2,4,6,12-tetraen-10,14-diyne-8-carboxylate |
| SMILES | C[C@@]1(O)C#C/C=C\C#C[C@H]2[C@@H]3O[C@]31c1ccccc1N2C(=O)OCCS(C)(=O)=O |
| InChI | InChI=1S/C21H19NO6S/c1-20(24)12-8-4-3-5-11-17-18-21(20,28-18)15-9-6-7-10-16(15)22(17)19(23)27-13-14-29(2,25)26/h3-4,6-7,9-10,17-18,24H,13-14H2,1-2H3/b4-3-/t17-,18-,20+,21+/m0/s1 |
| InChIKey | OHSQHUWEOZAANJ-HLITZRSCSA-N |
| XLogP | 0.98 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|