About 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid
7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid (PubChem CID 105497079) has the molecular formula C12H10ClNO2
and a molecular weight of 235.67 g/mol. Its IUPAC name is 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid.
Molecular Properties
| Compound Name | 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid |
| PubChem CID | 105497079 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid |
| SMILES | O=C(O)C1CCc2cc3ccc(Cl)cc3n21 |
| InChI | InChI=1S/C12H10ClNO2/c13-8-2-1-7-5-9-3-4-10(12(15)16)14(9)11(7)6-8/h1-2,5-6,10H,3-4H2,(H,15,16) |
| InChIKey | RDSWKSXAPJHQRK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
The IUPAC name of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid (CID 105497079) is 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid.
What is the SMILES notation for 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
The canonical SMILES for 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid is O=C(O)C1CCc2cc3ccc(Cl)cc3n21.
What is the InChIKey of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
The InChIKey is RDSWKSXAPJHQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO2/c13-8-2-1-7-5-9-3-4-10(12(15)16)14(9)11(7)6-8/h1-2,5-6,10H,3-4H2,(H,15,16).
What are the key properties of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid?
7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid has a molecular weight of 235.67 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-1-carboxylic acid is sourced from PubChem (CID 105497079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).