C11H9FN2O3 — CID 105497440
2-(8-fluoro-2-oxo-3H-quinazolin-4-yl)propanoic acid (PubChem CID 105497440) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 2-(8-fluoro-2-oxo-3H-quinazolin-4-yl)propanoic acid.
| Compound Name | 2-(8-fluoro-2-oxo-3H-quinazolin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 105497440 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-(8-fluoro-2-oxo-3H-quinazolin-4-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1[nH]c(=O)nc2c(F)cccc12 |
| InChI | InChI=1S/C11H9FN2O3/c1-5(10(15)16)8-6-3-2-4-7(12)9(6)14-11(17)13-8/h2-5H,1H3,(H,15,16)(H,13,14,17) |
| InChIKey | RFMFGGWXLYVPCH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |