About methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate
methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate (PubChem CID 10549771) has the molecular formula C26H25NO4
and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate |
| PubChem CID | 10549771 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate |
| SMILES | COC(=O)C(Oc1cc(OCc2c(C)cccc2C)ccc1C#N)c1ccccc1C |
| InChI | InChI=1S/C26H25NO4/c1-17-8-5-6-11-22(17)25(26(28)29-4)31-24-14-21(13-12-20(24)15-27)30-16-23-18(2)9-7-10-19(23)3/h5-14,25H,16H2,1-4H3 |
| InChIKey | QYCZVHRLLAGDBR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate?
The IUPAC name of methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate (CID 10549771) is methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate.
What is the SMILES notation for methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate?
The canonical SMILES for methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate is COC(=O)C(Oc1cc(OCc2c(C)cccc2C)ccc1C#N)c1ccccc1C.
What is the InChIKey of methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate?
The InChIKey is QYCZVHRLLAGDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25NO4/c1-17-8-5-6-11-22(17)25(26(28)29-4)31-24-14-21(13-12-20(24)15-27)30-16-23-18(2)9-7-10-19(23)3/h5-14,25H,16H2,1-4H3.
What are the key properties of methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate?
methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate has a molecular weight of 415.49 g/mol, XLogP of 5.36, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-cyano-5-[(2,6-dimethylphenyl)methoxy]phenoxy]-2-(2-methylphenyl)acetate is sourced from PubChem (CID 10549771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).