C28H33NO2 — CID 10549789
(1R,2R,4S,6S,9S,11R)-6-benzyl-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one (PubChem CID 10549789) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (1R,2R,4S,6S,9S,11R)-6-benzyl-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one.
| Compound Name | (1R,2R,4S,6S,9S,11R)-6-benzyl-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
|---|---|
| PubChem CID | 10549789 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (1R,2R,4S,6S,9S,11R)-6-benzyl-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
| SMILES | CC1(C)[C@H]2C[C@@H]3N4C(=O)[C@@](C)(Cc5ccccc5)C[C@@]4(c4ccccc4)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C28H33NO2/c1-25(2)21-15-22(25)27(4)23(16-21)29-24(30)26(3,17-19-11-7-5-8-12-19)18-28(29,31-27)20-13-9-6-10-14-20/h5-14,21-23H,15-18H2,1-4H3/t21-,22-,23+,26+,27-,28+/m1/s1 |
| InChIKey | KVFXKXSZGIAIAJ-PVIBSASFSA-N |
| XLogP | 5.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |