C27H28O4 — CID 10549832
1-[(4-hydroxyphenyl)methyl]-4-methoxy-8-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,7-diol (PubChem CID 10549832) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-[(4-hydroxyphenyl)methyl]-4-methoxy-8-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,7-diol.
| Compound Name | 1-[(4-hydroxyphenyl)methyl]-4-methoxy-8-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 10549832 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-[(4-hydroxyphenyl)methyl]-4-methoxy-8-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,7-diol |
| SMILES | COc1cc(O)c(Cc2ccc(O)cc2)c2c1-c1ccc(O)c(CC=C(C)C)c1CC2 |
| InChI | InChI=1S/C27H28O4/c1-16(2)4-9-20-19-10-11-22-23(14-17-5-7-18(28)8-6-17)25(30)15-26(31-3)27(22)21(19)12-13-24(20)29/h4-8,12-13,15,28-30H,9-11,14H2,1-3H3 |
| InChIKey | SVEKHSLQCDXEMG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|