About 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine
3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine (PubChem CID 105498371) has the molecular formula C7H9ClN2O3S
and a molecular weight of 236.68 g/mol. Its IUPAC name is 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine |
| PubChem CID | 105498371 |
| Molecular Formula | C7H9ClN2O3S |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(Cl)c1C1CCCS1(=O)=O |
| InChI | InChI=1S/C7H9ClN2O3S/c8-6-5(7(9)13-10-6)4-2-1-3-14(4,11)12/h4H,1-3,9H2 |
| InChIKey | BNPMCLOYJDVXFU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine?
The IUPAC name of 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine (CID 105498371) is 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine.
What is the SMILES notation for 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine?
The canonical SMILES for 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine is Nc1onc(Cl)c1C1CCCS1(=O)=O.
What is the InChIKey of 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine?
The InChIKey is BNPMCLOYJDVXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O3S/c8-6-5(7(9)13-10-6)4-2-1-3-14(4,11)12/h4H,1-3,9H2.
What are the key properties of 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine?
3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine has a molecular weight of 236.68 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(1,1-dioxothiolan-2-yl)-1,2-oxazol-5-amine is sourced from PubChem (CID 105498371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).