About [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine
[2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine (PubChem CID 105498746) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine.
Molecular Properties
| Compound Name | [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine |
| PubChem CID | 105498746 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine |
| SMILES | COc1nc(OC)c(CN)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3O2/c1-15-6-4(3-12)5(8(9,10)11)13-7(14-6)16-2/h3,12H2,1-2H3 |
| InChIKey | YBIWPBRKYIARIN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine?
The IUPAC name of [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine (CID 105498746) is [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine.
What is the SMILES notation for [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine?
The canonical SMILES for [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine is COc1nc(OC)c(CN)c(C(F)(F)F)n1.
What is the InChIKey of [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine?
The InChIKey is YBIWPBRKYIARIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c1-15-6-4(3-12)5(8(9,10)11)13-7(14-6)16-2/h3,12H2,1-2H3.
What are the key properties of [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine?
[2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine has a molecular weight of 237.18 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dimethoxy-6-(trifluoromethyl)pyrimidin-5-yl]methanamine is sourced from PubChem (CID 105498746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).