3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid

C6H7NO5S2 — CID 105498849

IUPAC3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid
SMILESCOc1nsc(S(C)(=O)=O)c1C(=O)O
InChIInChI=1S/C6H7NO5S2/c1-12-4-3(5(8)9)6(13-7-4)14(2,10)11/h1-2H3,(H,8,9)
InChIKeyHRUYUANKJBDFHF-UHFFFAOYSA-N
MW237.26 g/mol
LogP0.25
Rot. Bonds3

About 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid

3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid (PubChem CID 105498849) has the molecular formula C6H7NO5S2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid
PubChem CID105498849
Molecular FormulaC6H7NO5S2
Molecular Weight237.26 g/mol
Exact Mass236.98
IUPAC Name3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid
SMILESCOc1nsc(S(C)(=O)=O)c1C(=O)O
InChIInChI=1S/C6H7NO5S2/c1-12-4-3(5(8)9)6(13-7-4)14(2,10)11/h1-2H3,(H,8,9)
InChIKeyHRUYUANKJBDFHF-UHFFFAOYSA-N
XLogP0.25
TPSA93.56 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.26
LogP ≤ 50.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid (CID 105498849) is 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid is COc1nsc(S(C)(=O)=O)c1C(=O)O.
What is the InChIKey of 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is HRUYUANKJBDFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO5S2/c1-12-4-3(5(8)9)6(13-7-4)14(2,10)11/h1-2H3,(H,8,9).
What are the key properties of 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid?
3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 237.26 g/mol, XLogP of 0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5-methylsulfonyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 105498849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).