C11H12FN3S — CID 105499104
3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)thiomorpholine (PubChem CID 105499104) has the molecular formula C11H12FN3S and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)thiomorpholine.
| Compound Name | 3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)thiomorpholine |
|---|---|
| PubChem CID | 105499104 |
| Molecular Formula | C11H12FN3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)thiomorpholine |
| SMILES | Fc1ccn2cc(C3CSCCN3)nc2c1 |
| InChI | InChI=1S/C11H12FN3S/c12-8-1-3-15-6-9(14-11(15)5-8)10-7-16-4-2-13-10/h1,3,5-6,10,13H,2,4,7H2 |
| InChIKey | VAVDBEXLKVSWEA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |