C25H44O3Si — CID 10550085
(1R,2R,3R,8S)-8,12,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)tricyclo[9.3.1.03,8]pentadec-11-en-4-one (PubChem CID 10550085) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is (1R,2R,3R,8S)-8,12,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)tricyclo[9.3.1.03,8]pentadec-11-en-4-one.
| Compound Name | (1R,2R,3R,8S)-8,12,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)tricyclo[9.3.1.03,8]pentadec-11-en-4-one |
|---|---|
| PubChem CID | 10550085 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | (1R,2R,3R,8S)-8,12,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)tricyclo[9.3.1.03,8]pentadec-11-en-4-one |
| SMILES | CC1=C2CC[C@]3(C)CCCC(=O)[C@H]3[C@H](OCOCC[Si](C)(C)C)[C@H](CC1)C2(C)C |
| InChI | InChI=1S/C25H44O3Si/c1-18-10-11-20-23(28-17-27-15-16-29(5,6)7)22-21(26)9-8-13-25(22,4)14-12-19(18)24(20,2)3/h20,22-23H,8-17H2,1-7H3/t20-,22-,23+,25-/m0/s1 |
| InChIKey | ZFXIKJAGZLYJPA-ITAIVJFTSA-N |
| XLogP | 6.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|