C16H24INO4 — CID 10550090
(4S)-3-[(2R,3S,3aS,6aR)-2-ethyl-3a-iodo-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 10550090) has the molecular formula C16H24INO4 and a molecular weight of 421.28 g/mol. Its IUPAC name is (4S)-3-[(2R,3S,3aS,6aR)-2-ethyl-3a-iodo-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3S,3aS,6aR)-2-ethyl-3a-iodo-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10550090 |
| Molecular Formula | C16H24INO4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (4S)-3-[(2R,3S,3aS,6aR)-2-ethyl-3a-iodo-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC[C@H]1O[C@@H]2CCC[C@]2(I)[C@@H]1C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C16H24INO4/c1-4-11-13(16(17)7-5-6-12(16)22-11)14(19)18-10(9(2)3)8-21-15(18)20/h9-13H,4-8H2,1-3H3/t10-,11-,12-,13+,16-/m1/s1 |
| InChIKey | UJRHKPVJACFSAF-ZRTFPUAOSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|